| authorizations: |
registration not required
|
| accessURL: |
http://www.iedb.org/reference/1016340 |
| landingPage: |
http://www.iedb.org/assay/1812098 |
| type: |
Literature
|
| publicationVenue: |
J Immunol
|
| dates: |
1984
|
| study type: | b cell assays |
| subject species: | Streptococcus pneumoniae |
| fullName: |
L D Stein
N H Sigal
|
| method: |
antigen inhibition
|
| name: |
Heterogeneity of the human phosphocholine-specific B cell repertoire.
|
| description: |
The relative affinity of phosphocholine(PC)-specific mAbs from healthy donors to glycerophosphocholine (GPC) showed that the PC-specific antibodies are heterogeneous in its binding site, as some of them display higher affinities for GPC than for PC, some are similar, and some are more specific for PC than for GPC.
|
| name: |
iedb
|
| homePage: |
http://www.iedb.org |